C30H36BrN3O7 — CID 23898399
(5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23898399) has the molecular formula C30H36BrN3O7 and a molecular weight of 630.54 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23898399 |
| Molecular Formula | C30H36BrN3O7 |
| Molecular Weight | 630.54 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | (5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N(CCCCCO)C(C(=O)Nc4ccc(OC)cc4)C34CC(Br)[C@@H]2O4)cc1 |
| InChI | InChI=1S/C30H36BrN3O7/c1-3-40-21-13-9-18(10-14-21)32-27(36)23-24-29(38)34(15-5-4-6-16-35)26(30(24)17-22(31)25(23)41-30)28(37)33-19-7-11-20(39-2)12-8-19/h7-14,22-26,35H,3-6,15-17H2,1-2H3,(H,32,36)(H,33,37)/t22?,23-,24-,25-,26?,30?/m0/s1 |
| InChIKey | ZBMDSFQEIGKTJN-DVMXDDCXSA-N |
| XLogP | 3.58 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|