C28H40BrN3O6 — CID 23954008
(5R,6R,7S)-8-bromo-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23954008) has the molecular formula C28H40BrN3O6 and a molecular weight of 594.55 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23954008 |
| Molecular Formula | C28H40BrN3O6 |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@@H]3OC4(CC3Br)C(C(=O)NC(C)(C)C)N(CCCCCCO)C(=O)[C@H]24)cc1 |
| InChI | InChI=1S/C28H40BrN3O6/c1-5-37-18-12-10-17(11-13-18)30-24(34)20-21-26(36)32(14-8-6-7-9-15-33)23(25(35)31-27(2,3)4)28(21)16-19(29)22(20)38-28/h10-13,19-23,33H,5-9,14-16H2,1-4H3,(H,30,34)(H,31,35)/t19?,20-,21+,22-,23?,28?/m1/s1 |
| InChIKey | YAKBPAOXVRFKQD-VIRDVTOWSA-N |
| XLogP | 3.24 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|