C26H36BrN3O6 — CID 23982198
(5R,6S,7R)-8-bromo-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23982198) has the molecular formula C26H36BrN3O6 and a molecular weight of 566.49 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23982198 |
| Molecular Formula | C26H36BrN3O6 |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)C1N(CCCCO)C(=O)[C@@H]2[C@H](C(=O)Nc3ccc(OCC)cc3)[C@H]3OC12CC3Br |
| InChI | InChI=1S/C26H36BrN3O6/c1-3-5-12-28-24(33)22-26-15-18(27)21(36-26)19(20(26)25(34)30(22)13-6-7-14-31)23(32)29-16-8-10-17(11-9-16)35-4-2/h8-11,18-22,31H,3-7,12-15H2,1-2H3,(H,28,33)(H,29,32)/t18?,19-,20-,21-,22?,26?/m0/s1 |
| InChIKey | KXQGUJHAAHPRFX-NRNGZIOXSA-N |
| XLogP | 2.46 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|