C18H27BrN2O6 — CID 23950581
ethyl (5R,6R,7S)-8-bromo-2-(butylcarbamoyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23950581) has the molecular formula C18H27BrN2O6 and a molecular weight of 447.33 g/mol. Its IUPAC name is ethyl (5R,6R,7S)-8-bromo-2-(butylcarbamoyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6R,7S)-8-bromo-2-(butylcarbamoyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23950581 |
| Molecular Formula | C18H27BrN2O6 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | ethyl (5R,6R,7S)-8-bromo-2-(butylcarbamoyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCCCNC(=O)C1N(CCO)C(=O)[C@@H]2[C@@H](C(=O)OCC)[C@@H]3OC12CC3Br |
| InChI | InChI=1S/C18H27BrN2O6/c1-3-5-6-20-15(23)14-18-9-10(19)13(27-18)11(17(25)26-4-2)12(18)16(24)21(14)7-8-22/h10-14,22H,3-9H2,1-2H3,(H,20,23)/t10?,11-,12+,13-,14?,18?/m1/s1 |
| InChIKey | SNXUYLOSUHCRRP-ZVSXXVAUSA-N |
| XLogP | 0.21 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|