C24H31BrN2O6 — CID 23978614
ethyl (5R,6R,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23978614) has the molecular formula C24H31BrN2O6 and a molecular weight of 523.42 g/mol. Its IUPAC name is ethyl (5R,6R,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6R,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23978614 |
| Molecular Formula | C24H31BrN2O6 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | ethyl (5R,6R,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)Nc2cc(C)ccc2C)N(CCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C24H31BrN2O6/c1-4-32-23(31)17-18-22(30)27(9-5-6-10-28)20(24(18)12-15(25)19(17)33-24)21(29)26-16-11-13(2)7-8-14(16)3/h7-8,11,15,17-20,28H,4-6,9-10,12H2,1-3H3,(H,26,29)/t15?,17-,18+,19-,20?,24?/m1/s1 |
| InChIKey | XZVNQDIRVYXDHF-NNDURDSHSA-N |
| XLogP | 2.33 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|