C23H37BrN2O6 — CID 23978608
ethyl (5R,6R,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-2-(pentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23978608) has the molecular formula C23H37BrN2O6 and a molecular weight of 517.46 g/mol. Its IUPAC name is ethyl (5R,6R,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-2-(pentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6R,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-2-(pentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23978608 |
| Molecular Formula | C23H37BrN2O6 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | ethyl (5R,6R,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-2-(pentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCCC(C)NC(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@@H](C(=O)OCC)[C@@H]3OC12CC3Br |
| InChI | InChI=1S/C23H37BrN2O6/c1-4-10-14(3)25-20(28)19-23-13-15(24)18(32-23)16(22(30)31-5-2)17(23)21(29)26(19)11-8-6-7-9-12-27/h14-19,27H,4-13H2,1-3H3,(H,25,28)/t14?,15?,16-,17+,18-,19?,23?/m1/s1 |
| InChIKey | BTNTYMSSALPUEI-PPXDTYBQSA-N |
| XLogP | 2.15 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|