C24H30BrN5O6 — CID 23982862
ethyl (1R,2R,5S,6S,7R)-2-(benzotriazol-1-ylmethylcarbamoyl)-8-bromo-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23982862) has the molecular formula C24H30BrN5O6 and a molecular weight of 564.44 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S,7R)-2-(benzotriazol-1-ylmethylcarbamoyl)-8-bromo-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S,7R)-2-(benzotriazol-1-ylmethylcarbamoyl)-8-bromo-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23982862 |
| Molecular Formula | C24H30BrN5O6 |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | ethyl (1R,2R,5S,6S,7R)-2-(benzotriazol-1-ylmethylcarbamoyl)-8-bromo-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2O[C@@]3(CC2Br)[C@H](C(=O)NCn2nnc4ccccc42)N(CCCCCO)C(=O)[C@@H]13 |
| InChI | InChI=1S/C24H30BrN5O6/c1-2-35-23(34)17-18-22(33)29(10-6-3-7-11-31)20(24(18)12-14(25)19(17)36-24)21(32)26-13-30-16-9-5-4-8-15(16)27-28-30/h4-5,8-9,14,17-20,31H,2-3,6-7,10-13H2,1H3,(H,26,32)/t14?,17-,18+,19-,20-,24+/m0/s1 |
| InChIKey | JRRDCBLKUUJQQO-VLRINZPZSA-N |
| XLogP | 0.98 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|