C23H30N6O5 — CID 23782550
(5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782550) has the molecular formula C23H30N6O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782550 |
| Molecular Formula | C23H30N6O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)NCn2nnc4ccccc42)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C23H30N6O5/c1-24-20(31)17-16-9-10-23(34-16)18(17)22(33)28(11-5-2-6-12-30)19(23)21(32)25-13-29-15-8-4-3-7-14(15)26-27-29/h3-4,7-8,16-19,30H,2,5-6,9-13H2,1H3,(H,24,31)(H,25,32)/t16-,17+,18-,19?,23?/m0/s1 |
| InChIKey | HFVDCBJIFNFREO-MQEWTYCZSA-N |
| XLogP | -0.21 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|