C26H36N6O5 — CID 23782578
(5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782578) has the molecular formula C26H36N6O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782578 |
| Molecular Formula | C26H36N6O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | (5R,6S,7S)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@@]12CCC3(O1)C(C(=O)NCn1nnc4ccccc41)N(CCCCCCO)C(=O)[C@@H]3[C@@H]2C(=O)NC |
| InChI | InChI=1S/C26H36N6O5/c1-3-25-12-13-26(37-25)20(19(25)22(34)27-2)24(36)31(14-8-4-5-9-15-33)21(26)23(35)28-16-32-18-11-7-6-10-17(18)29-30-32/h6-7,10-11,19-21,33H,3-5,8-9,12-16H2,1-2H3,(H,27,34)(H,28,35)/t19-,20+,21?,25+,26?/m1/s1 |
| InChIKey | WOCBYVOCCWZZJB-FQKPGTOISA-N |
| XLogP | 0.96 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|