C29H34N6O5 — CID 23924862
(5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-benzyl-7-ethyl-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23924862) has the molecular formula C29H34N6O5 and a molecular weight of 546.63 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-benzyl-7-ethyl-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-benzyl-7-ethyl-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23924862 |
| Molecular Formula | C29H34N6O5 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-benzyl-7-ethyl-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@]12CCC3(O1)C(C(=O)NCn1nnc4ccccc41)N(CCCO)C(=O)[C@@H]3[C@H]2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H34N6O5/c1-2-28-13-14-29(40-28)23(22(28)25(37)30-17-19-9-4-3-5-10-19)27(39)34(15-8-16-36)24(29)26(38)31-18-35-21-12-7-6-11-20(21)32-33-35/h3-7,9-12,22-24,36H,2,8,13-18H2,1H3,(H,30,37)(H,31,38)/t22-,23-,24?,28+,29?/m0/s1 |
| InChIKey | MGLDCDLNOBRFBN-PFINFNDISA-N |
| XLogP | 1.36 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |