C29H34N6O5 — CID 23753951
(5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23753951) has the molecular formula C29H34N6O5 and a molecular weight of 546.63 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23753951 |
| Molecular Formula | C29H34N6O5 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCC(CO)N1C(=O)[C@@H]2[C@@H](C(=O)Nc3ccccc3)[C@@]3(CC)CCC2(O3)C1C(=O)NCn1nnc2ccccc21 |
| InChI | InChI=1S/C29H34N6O5/c1-3-19(16-36)35-24(26(38)30-17-34-21-13-9-8-12-20(21)32-33-34)29-15-14-28(4-2,40-29)22(23(29)27(35)39)25(37)31-18-10-6-5-7-11-18/h5-13,19,22-24,36H,3-4,14-17H2,1-2H3,(H,30,38)(H,31,37)/t19?,22-,23-,24?,28+,29?/m0/s1 |
| InChIKey | ZPMHVMQJHCVIMQ-ZWYYXUFCSA-N |
| XLogP | 2.07 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |