C30H36N6O5 — CID 23782862
(5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782862) has the molecular formula C30H36N6O5 and a molecular weight of 560.66 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782862 |
| Molecular Formula | C30H36N6O5 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)C[C@H](CO)N1C(=O)[C@@H]2[C@@H](C(=O)Nc3ccccc3)[C@@]3(C)CCC2(O3)C1C(=O)NCn1nnc2ccccc21 |
| InChI | InChI=1S/C30H36N6O5/c1-18(2)15-20(16-37)36-25(27(39)31-17-35-22-12-8-7-11-21(22)33-34-35)30-14-13-29(3,41-30)23(24(30)28(36)40)26(38)32-19-9-5-4-6-10-19/h4-12,18,20,23-25,37H,13-17H2,1-3H3,(H,31,39)(H,32,38)/t20-,23+,24+,25?,29-,30?/m1/s1 |
| InChIKey | AKJLHSGFOPKWOB-USUDEVCISA-N |
| XLogP | 2.32 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |