C31H45N3O6 — CID 23952484
(5R,6R,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23952484) has the molecular formula C31H45N3O6 and a molecular weight of 555.72 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23952484 |
| Molecular Formula | C31H45N3O6 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.33 |
| IUPAC Name | (5R,6R,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N([C@@H](CO)CC(C)C)C(C(=O)NC4CCCCC4)C34CC[C@@]2(C)O4)cc1 |
| InChI | InChI=1S/C31H45N3O6/c1-5-39-23-13-11-21(12-14-23)32-27(36)24-25-29(38)34(22(18-35)17-19(2)3)26(31(25)16-15-30(24,4)40-31)28(37)33-20-9-7-6-8-10-20/h11-14,19-20,22,24-26,35H,5-10,15-18H2,1-4H3,(H,32,36)(H,33,37)/t22-,24+,25+,26?,30-,31?/m1/s1 |
| InChIKey | KCPZWQJCWNXXCN-UHAYXOPOSA-N |
| XLogP | 3.64 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |