C31H38ClN3O5S — CID 23925303
(5S,6S,7R)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925303) has the molecular formula C31H38ClN3O5S and a molecular weight of 600.18 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925303 |
| Molecular Formula | C31H38ClN3O5S |
| Molecular Weight | 600.18 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | (5S,6S,7R)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N([C@@H](CO)CC(C)C)C(C(=O)Nc4ccc(Cl)cc4)C34CC[C@@]2(C)S4)cc1 |
| InChI | InChI=1S/C31H38ClN3O5S/c1-5-40-23-12-10-21(11-13-23)33-27(37)24-25-29(39)35(22(17-36)16-18(2)3)26(31(25)15-14-30(24,4)41-31)28(38)34-20-8-6-19(32)7-9-20/h6-13,18,22,24-26,36H,5,14-17H2,1-4H3,(H,33,37)(H,34,38)/t22-,24+,25+,26?,30-,31?/m1/s1 |
| InChIKey | DSRZBOWTQKQGIK-UHAYXOPOSA-N |
| XLogP | 5.20 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.18 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |