C33H41N3O5S — CID 23981263
(5S,6S,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981263) has the molecular formula C33H41N3O5S and a molecular weight of 591.77 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981263 |
| Molecular Formula | C33H41N3O5S |
| Molecular Weight | 591.77 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | (5S,6S,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N([C@H](CO)c4ccccc4)C(C(=O)NC4CCCCC4)C34CC[C@@]2(C)S4)cc1 |
| InChI | InChI=1S/C33H41N3O5S/c1-3-41-24-16-14-23(15-17-24)34-29(38)26-27-31(40)36(25(20-37)21-10-6-4-7-11-21)28(33(27)19-18-32(26,2)42-33)30(39)35-22-12-8-5-9-13-22/h4,6-7,10-11,14-17,22,25-28,37H,3,5,8-9,12-13,18-20H2,1-2H3,(H,34,38)(H,35,39)/t25-,26+,27+,28?,32-,33?/m1/s1 |
| InChIKey | MMUYYFZVFQSCCS-WEZZZIFMSA-N |
| XLogP | 4.69 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.77 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |