C33H34ClN3O5S — CID 23841306
(5S,6S,7R)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23841306) has the molecular formula C33H34ClN3O5S and a molecular weight of 620.17 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23841306 |
| Molecular Formula | C33H34ClN3O5S |
| Molecular Weight | 620.17 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | (5S,6S,7R)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N([C@H](CO)c4ccccc4)C(C(=O)Nc4ccc(Cl)cc4)C34CC[C@@]2(C)S4)cc1 |
| InChI | InChI=1S/C33H34ClN3O5S/c1-3-42-24-15-13-23(14-16-24)35-29(39)26-27-31(41)37(25(19-38)20-7-5-4-6-8-20)28(33(27)18-17-32(26,2)43-33)30(40)36-22-11-9-21(34)10-12-22/h4-16,25-28,38H,3,17-19H2,1-2H3,(H,35,39)(H,36,40)/t25-,26+,27+,28?,32-,33?/m1/s1 |
| InChIKey | MYEIPQVCGZOSMG-WEZZZIFMSA-N |
| XLogP | 5.53 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.17 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |