C32H41N3O6S — CID 23981087
(5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981087) has the molecular formula C32H41N3O6S and a molecular weight of 595.76 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981087 |
| Molecular Formula | C32H41N3O6S |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | (5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(C(CO)CC(C)C)C(C(=O)Nc4ccc(OC)cc4)C34CC[C@@]2(C)S4)cc1 |
| InChI | InChI=1S/C32H41N3O6S/c1-6-41-24-13-9-20(10-14-24)33-28(37)25-26-30(39)35(22(18-36)17-19(2)3)27(32(26)16-15-31(25,4)42-32)29(38)34-21-7-11-23(40-5)12-8-21/h7-14,19,22,25-27,36H,6,15-18H2,1-5H3,(H,33,37)(H,34,38)/t22?,25-,26-,27?,31+,32?/m0/s1 |
| InChIKey | GEHIVLYUKBKPQU-WZGGXILBSA-N |
| XLogP | 4.56 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |