C36H41N3O5S — CID 23953154
(5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953154) has the molecular formula C36H41N3O5S and a molecular weight of 627.81 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953154 |
| Molecular Formula | C36H41N3O5S |
| Molecular Weight | 627.81 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | (5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N([C@@H](CO)Cc4ccccc4)C(C(=O)Nc4c(C)cccc4C)C34CC[C@@]2(C)S4)cc1 |
| InChI | InChI=1S/C36H41N3O5S/c1-5-44-27-16-14-25(15-17-27)37-32(41)28-29-34(43)39(26(21-40)20-24-12-7-6-8-13-24)31(36(29)19-18-35(28,4)45-36)33(42)38-30-22(2)10-9-11-23(30)3/h6-17,26,28-29,31,40H,5,18-21H2,1-4H3,(H,37,41)(H,38,42)/t26-,28+,29+,31?,35-,36?/m1/s1 |
| InChIKey | XERVZANTBBYHFK-LAMAXBPXSA-N |
| XLogP | 5.36 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.81 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |