C30H36ClN3O5S — CID 23812590
(5S,6S,7R)-2-N-(2-chloro-6-methylphenyl)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812590) has the molecular formula C30H36ClN3O5S and a molecular weight of 586.15 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(2-chloro-6-methylphenyl)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(2-chloro-6-methylphenyl)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812590 |
| Molecular Formula | C30H36ClN3O5S |
| Molecular Weight | 586.15 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | (5S,6S,7R)-2-N-(2-chloro-6-methylphenyl)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(CCCCO)C(C(=O)Nc4c(C)cccc4Cl)C34CC[C@@]2(C)S4)cc1 |
| InChI | InChI=1S/C30H36ClN3O5S/c1-4-39-20-12-10-19(11-13-20)32-26(36)22-23-28(38)34(16-5-6-17-35)25(30(23)15-14-29(22,3)40-30)27(37)33-24-18(2)8-7-9-21(24)31/h7-13,22-23,25,35H,4-6,14-17H2,1-3H3,(H,32,36)(H,33,37)/t22-,23-,25?,29+,30?/m0/s1 |
| InChIKey | CYLMZRNETJRZMG-QZXPKIJFSA-N |
| XLogP | 4.88 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.15 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|