C27H39N3O5S — CID 23869233
(5S,6R,7S)-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869233) has the molecular formula C27H39N3O5S and a molecular weight of 517.69 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869233 |
| Molecular Formula | C27H39N3O5S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | (5S,6R,7S)-2-N-butyl-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)C1N(CCCCO)C(=O)[C@@H]2[C@H](C(=O)Nc3ccc(OCC)cc3)[C@]3(C)CCC12S3 |
| InChI | InChI=1S/C27H39N3O5S/c1-4-6-15-28-24(33)22-27-14-13-26(3,36-27)20(21(27)25(34)30(22)16-7-8-17-31)23(32)29-18-9-11-19(12-10-18)35-5-2/h9-12,20-22,31H,4-8,13-17H2,1-3H3,(H,28,33)(H,29,32)/t20-,21+,22?,26+,27?/m1/s1 |
| InChIKey | ZWXPROQXQRPKMU-REHOWLNLSA-N |
| XLogP | 3.19 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|