C33H43N3O5S — CID 23897389
(5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897389) has the molecular formula C33H43N3O5S and a molecular weight of 593.79 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897389 |
| Molecular Formula | C33H43N3O5S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | (5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(CCCCCCO)C(C(=O)Nc4c(C)cccc4C)C34CC[C@@]2(C)S4)cc1 |
| InChI | InChI=1S/C33H43N3O5S/c1-5-41-24-15-13-23(14-16-24)34-29(38)25-26-31(40)36(19-8-6-7-9-20-37)28(33(26)18-17-32(25,4)42-33)30(39)35-27-21(2)11-10-12-22(27)3/h10-16,25-26,28,37H,5-9,17-20H2,1-4H3,(H,34,38)(H,35,39)/t25-,26-,28?,32+,33?/m0/s1 |
| InChIKey | URJFSYOKIYCEAO-LTMSWLBWSA-N |
| XLogP | 5.31 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|