C28H32ClN3O4S — CID 23754320
(5S,6S,7R)-2-N-(4-chlorophenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754320) has the molecular formula C28H32ClN3O4S and a molecular weight of 542.10 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(4-chlorophenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(4-chlorophenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754320 |
| Molecular Formula | C28H32ClN3O4S |
| Molecular Weight | 542.10 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (5S,6S,7R)-2-N-(4-chlorophenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C[C@]12CCC3(S1)C(C(=O)Nc1ccc(Cl)cc1)N(CCCCCO)C(=O)[C@@H]3[C@H]2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H32ClN3O4S/c1-27-14-15-28(37-27)22(21(27)24(34)30-19-8-4-2-5-9-19)26(36)32(16-6-3-7-17-33)23(28)25(35)31-20-12-10-18(29)11-13-20/h2,4-5,8-13,21-23,33H,3,6-7,14-17H2,1H3,(H,30,34)(H,31,35)/t21-,22-,23?,27+,28?/m0/s1 |
| InChIKey | XWUAQNAHMGERLO-VUEAGESLSA-N |
| XLogP | 4.56 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.10 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|