C27H30ClN3O4S — CID 23841006
(5S,6R,7S)-6-N-benzyl-2-N-(4-chlorophenyl)-3-(3-hydroxypropyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23841006) has the molecular formula C27H30ClN3O4S and a molecular weight of 528.07 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-2-N-(4-chlorophenyl)-3-(3-hydroxypropyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-2-N-(4-chlorophenyl)-3-(3-hydroxypropyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23841006 |
| Molecular Formula | C27H30ClN3O4S |
| Molecular Weight | 528.07 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-2-N-(4-chlorophenyl)-3-(3-hydroxypropyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C[C@@]12CCC3(S1)C(C(=O)Nc1ccc(Cl)cc1)N(CCCO)C(=O)[C@@H]3[C@@H]2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H30ClN3O4S/c1-26-12-13-27(36-26)21(20(26)23(33)29-16-17-6-3-2-4-7-17)25(35)31(14-5-15-32)22(27)24(34)30-19-10-8-18(28)9-11-19/h2-4,6-11,20-22,32H,5,12-16H2,1H3,(H,29,33)(H,30,34)/t20-,21+,22?,26+,27?/m1/s1 |
| InChIKey | FJCNTLSQHAYBJT-REHOWLNLSA-N |
| XLogP | 3.46 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.07 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |