C31H39N3O4S — CID 23980931
(5S,6R,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23980931) has the molecular formula C31H39N3O4S and a molecular weight of 549.74 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23980931 |
| Molecular Formula | C31H39N3O4S |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2N(CCCCCO)C(=O)[C@@H]3[C@H](C(=O)NCc4ccccc4)[C@]4(C)CCC23S4)c1 |
| InChI | InChI=1S/C31H39N3O4S/c1-20-12-13-21(2)23(18-20)33-28(37)26-31-15-14-30(3,39-31)24(27(36)32-19-22-10-6-4-7-11-22)25(31)29(38)34(26)16-8-5-9-17-35/h4,6-7,10-13,18,24-26,35H,5,8-9,14-17,19H2,1-3H3,(H,32,36)(H,33,37)/t24-,25+,26?,30+,31?/m1/s1 |
| InChIKey | OUTNBENBZFUSFK-KFJQEDMNSA-N |
| XLogP | 4.20 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|