C31H39N3O4S — CID 23981135
(5S,6S,7R)-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981135) has the molecular formula C31H39N3O4S and a molecular weight of 549.74 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981135 |
| Molecular Formula | C31H39N3O4S |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | (5S,6S,7R)-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)Cc3ccccc3)C(C(=O)Nc3cc(C)ccc3C)C23CC[C@@]1(C)S3 |
| InChI | InChI=1S/C31H39N3O4S/c1-5-15-32-27(36)24-25-29(38)34(22(18-35)17-21-9-7-6-8-10-21)26(31(25)14-13-30(24,4)39-31)28(37)33-23-16-19(2)11-12-20(23)3/h6-12,16,22,24-26,35H,5,13-15,17-18H2,1-4H3,(H,32,36)(H,33,37)/t22-,24+,25+,26?,30-,31?/m1/s1 |
| InChIKey | CCKMEOVIJGLNTH-UHAYXOPOSA-N |
| XLogP | 3.85 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |