C34H37N3O4S — CID 23869435
(5S,6S,7R)-2-N,6-N-dibenzyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869435) has the molecular formula C34H37N3O4S and a molecular weight of 583.75 g/mol. Its IUPAC name is (5S,6S,7R)-2-N,6-N-dibenzyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N,6-N-dibenzyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869435 |
| Molecular Formula | C34H37N3O4S |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | (5S,6S,7R)-2-N,6-N-dibenzyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C[C@]12CCC3(S1)C(C(=O)NCc1ccccc1)N([C@@H](CO)Cc1ccccc1)C(=O)[C@@H]3[C@H]2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H37N3O4S/c1-33-17-18-34(42-33)28(27(33)30(39)35-20-24-13-7-3-8-14-24)32(41)37(26(22-38)19-23-11-5-2-6-12-23)29(34)31(40)36-21-25-15-9-4-10-16-25/h2-16,26-29,38H,17-22H2,1H3,(H,35,39)(H,36,40)/t26-,27+,28+,29?,33-,34?/m1/s1 |
| InChIKey | DCAPPNXBYIKUFC-DKVVGICDSA-N |
| XLogP | 3.70 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |