C30H44N4O5S — CID 23896991
(5S,6R,7S)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23896991) has the molecular formula C30H44N4O5S and a molecular weight of 572.77 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23896991 |
| Molecular Formula | C30H44N4O5S |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)CC(CO)N1C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@]3(C)CCC2(S3)C1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C30H44N4O5S/c1-20(2)17-22(19-35)34-25(27(37)31-11-12-33-13-15-39-16-14-33)30-10-9-29(3,40-30)23(24(30)28(34)38)26(36)32-18-21-7-5-4-6-8-21/h4-8,20,22-25,35H,9-19H2,1-3H3,(H,31,37)(H,32,36)/t22?,23-,24+,25?,29+,30?/m1/s1 |
| InChIKey | SEOZOJIWKGLRNJ-OFVPOCEOSA-N |
| XLogP | 1.64 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |