C30H43N3O4S — CID 23897297
(5S,6S,7R)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897297) has the molecular formula C30H43N3O4S and a molecular weight of 541.76 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897297 |
| Molecular Formula | C30H43N3O4S |
| Molecular Weight | 541.76 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | (5S,6S,7R)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)C[C@H](CO)N1C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@@]3(C)CCC2(S3)C1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C30H43N3O4S/c1-19(2)16-22(18-34)33-25(27(36)32-21-12-8-5-9-13-21)30-15-14-29(3,38-30)23(24(30)28(33)37)26(35)31-17-20-10-6-4-7-11-20/h4,6-7,10-11,19,21-25,34H,5,8-9,12-18H2,1-3H3,(H,31,35)(H,32,36)/t22-,23+,24+,25?,29-,30?/m1/s1 |
| InChIKey | HFUXXVWKXROHRF-AVOGRCKQSA-N |
| XLogP | 3.64 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.76 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |