C28H39N3O5 — CID 23755082
(5R,6S,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxypropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23755082) has the molecular formula C28H39N3O5 and a molecular weight of 497.64 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxypropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxypropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23755082 |
| Molecular Formula | C28H39N3O5 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxypropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC1CC23O[C@]1(C)[C@@H](C(=O)NCc1ccccc1)[C@H]2C(=O)N([C@H](C)CO)C3C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H39N3O5/c1-17-14-28-22(21(27(17,3)36-28)24(33)29-15-19-10-6-4-7-11-19)26(35)31(18(2)16-32)23(28)25(34)30-20-12-8-5-9-13-20/h4,6-7,10-11,17-18,20-23,32H,5,8-9,12-16H2,1-3H3,(H,29,33)(H,30,34)/t17?,18-,21-,22+,23?,27+,28?/m1/s1 |
| InChIKey | FKFSZPMFHZVYQI-HHVADTMSSA-N |
| XLogP | 2.14 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |