C28H41N3O5 — CID 23982296
(5R,6R,7R)-6-N-benzyl-2-N-tert-butyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23982296) has the molecular formula C28H41N3O5 and a molecular weight of 499.65 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-2-N-tert-butyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-2-N-tert-butyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23982296 |
| Molecular Formula | C28H41N3O5 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-2-N-tert-butyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)[C@H](CO)N1C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@]3(C)OC2(CC3C)C1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C28H41N3O5/c1-16(2)19(15-32)31-22(24(34)30-26(4,5)6)28-13-17(3)27(7,36-28)20(21(28)25(31)35)23(33)29-14-18-11-9-8-10-12-18/h8-12,16-17,19-22,32H,13-15H2,1-7H3,(H,29,33)(H,30,34)/t17?,19-,20-,21-,22?,27+,28?/m0/s1 |
| InChIKey | YCSPLXGMIMTGFH-UNYGNEGZSA-N |
| XLogP | 2.25 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |