C33H34ClN3O5 — CID 23954455
(5R,6R,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23954455) has the molecular formula C33H34ClN3O5 and a molecular weight of 588.10 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23954455 |
| Molecular Formula | C33H34ClN3O5 |
| Molecular Weight | 588.10 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC1CC23O[C@@]1(C)[C@H](C(=O)NCc1ccccc1)[C@H]2C(=O)N([C@H](CO)c1ccccc1)C3C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H34ClN3O5/c1-20-17-33-27(26(32(20,2)42-33)29(39)35-18-21-9-5-3-6-10-21)31(41)37(25(19-38)22-11-7-4-8-12-22)28(33)30(40)36-24-15-13-23(34)14-16-24/h3-16,20,25-28,38H,17-19H2,1-2H3,(H,35,39)(H,36,40)/t20?,25-,26+,27+,28?,32-,33?/m1/s1 |
| InChIKey | KRJZFYCRPMZWNC-WFHVDJHWSA-N |
| XLogP | 4.34 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.10 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |