C30H36ClN3O5 — CID 23926555
(5R,6R,7R)-2-N-(4-chlorophenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23926555) has the molecular formula C30H36ClN3O5 and a molecular weight of 554.09 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(4-chlorophenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(4-chlorophenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23926555 |
| Molecular Formula | C30H36ClN3O5 |
| Molecular Weight | 554.09 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | (5R,6R,7R)-2-N-(4-chlorophenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@H](C)[C@H](CO)N1C(=O)[C@@H]2[C@@H](C(=O)Nc3ccccc3)[C@]3(C)OC2(CC3C)C1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H36ClN3O5/c1-5-17(2)22(16-35)34-25(27(37)33-21-13-11-19(31)12-14-21)30-15-18(3)29(4,39-30)23(24(30)28(34)38)26(36)32-20-9-7-6-8-10-20/h6-14,17-18,22-25,35H,5,15-16H2,1-4H3,(H,32,36)(H,33,37)/t17-,18?,22-,23-,24-,25?,29+,30?/m0/s1 |
| InChIKey | UAUWCLPMXKPFLK-SSMDKEJJSA-N |
| XLogP | 4.33 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.09 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |