C26H36ClN3O5 — CID 23896587
(5R,6R,7R)-2-N-(4-chlorophenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23896587) has the molecular formula C26H36ClN3O5 and a molecular weight of 506.04 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(4-chlorophenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(4-chlorophenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23896587 |
| Molecular Formula | C26H36ClN3O5 |
| Molecular Weight | 506.04 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (5R,6R,7R)-2-N-(4-chlorophenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)Nc3ccc(Cl)cc3)C23CC[C@@]1(C)O3 |
| InChI | InChI=1S/C26H36ClN3O5/c1-5-13-28-22(32)19-20-24(34)30(18(14-31)15(3)6-2)21(26(20)12-11-25(19,4)35-26)23(33)29-17-9-7-16(27)8-10-17/h7-10,15,18-21,31H,5-6,11-14H2,1-4H3,(H,28,32)(H,29,33)/t15-,18-,19-,20-,21?,25+,26?/m0/s1 |
| InChIKey | VSGKSWZYNBIZPF-NXCVKGJYSA-N |
| XLogP | 2.98 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.04 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |