C27H38N2O6 — CID 23838386
ethyl (5R,6S,7S)-2-[(2,6-dimethylphenyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23838386) has the molecular formula C27H38N2O6 and a molecular weight of 486.61 g/mol. Its IUPAC name is ethyl (5R,6S,7S)-2-[(2,6-dimethylphenyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7S)-2-[(2,6-dimethylphenyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23838386 |
| Molecular Formula | C27H38N2O6 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | ethyl (5R,6S,7S)-2-[(2,6-dimethylphenyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)Nc3c(C)cccc3C)C23CC[C@]1(C)O3 |
| InChI | InChI=1S/C27H38N2O6/c1-7-15(3)18(14-30)29-22(23(31)28-21-16(4)10-9-11-17(21)5)27-13-12-26(6,35-27)20(19(27)24(29)32)25(33)34-8-2/h9-11,15,18-20,22,30H,7-8,12-14H2,1-6H3,(H,28,31)/t15-,18-,19-,20+,22?,26-,27?/m0/s1 |
| InChIKey | URRUBMGVOVXFLD-OOCPBRRMSA-N |
| XLogP | 2.98 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |