C30H46N4O5 — CID 23982297
(5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23982297) has the molecular formula C30H46N4O5 and a molecular weight of 542.72 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23982297 |
| Molecular Formula | C30H46N4O5 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | (5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)C(C)C)C(C(=O)Nc3ccc(N(CC)CC)cc3)C23CC(C)[C@@]1(C)O3 |
| InChI | InChI=1S/C30H46N4O5/c1-8-15-31-26(36)23-24-28(38)34(22(17-35)18(4)5)25(30(24)16-19(6)29(23,7)39-30)27(37)32-20-11-13-21(14-12-20)33(9-2)10-3/h11-14,18-19,22-25,35H,8-10,15-17H2,1-7H3,(H,31,36)(H,32,37)/t19?,22-,23-,24-,25?,29+,30?/m0/s1 |
| InChIKey | DRIHNHXCBCLKRM-DFNNHVKUSA-N |
| XLogP | 3.03 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|