C39H48N4O6 — CID 23981995
(5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981995) has the molecular formula C39H48N4O6 and a molecular weight of 668.84 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981995 |
| Molecular Formula | C39H48N4O6 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N([C@@H](CO)Cc4ccccc4)C(C(=O)Nc4ccc(N(CC)CC)cc4)C34CC(C)[C@]2(C)O4)cc1 |
| InChI | InChI=1S/C39H48N4O6/c1-6-42(7-2)29-18-14-27(15-19-29)41-36(46)34-39-23-25(4)38(5,49-39)32(35(45)40-28-16-20-31(21-17-28)48-8-3)33(39)37(47)43(34)30(24-44)22-26-12-10-9-11-13-26/h9-21,25,30,32-34,44H,6-8,22-24H2,1-5H3,(H,40,45)(H,41,46)/t25?,30-,32-,33+,34?,38+,39?/m1/s1 |
| InChIKey | HXLYDEQPPKNZRC-MRJGTTBNSA-N |
| XLogP | 5.12 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|