C37H44N4O6 — CID 23782447
(5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782447) has the molecular formula C37H44N4O6 and a molecular weight of 640.78 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782447 |
| Molecular Formula | C37H44N4O6 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@@H]3CCC4(O3)C(C(=O)Nc3ccc(N(CC)CC)cc3)N([C@@H](CO)Cc3ccccc3)C(=O)[C@H]24)cc1 |
| InChI | InChI=1S/C37H44N4O6/c1-4-40(5-2)27-16-12-25(13-17-27)39-35(44)33-37-21-20-30(47-37)31(34(43)38-26-14-18-29(19-15-26)46-6-3)32(37)36(45)41(33)28(23-42)22-24-10-8-7-9-11-24/h7-19,28,30-33,42H,4-6,20-23H2,1-3H3,(H,38,43)(H,39,44)/t28-,30+,31-,32+,33?,37?/m1/s1 |
| InChIKey | DTCXKSUQOMGBNR-GUUGNKPCSA-N |
| XLogP | 4.49 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|