C30H38N4O6 — CID 23753243
(5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23753243) has the molecular formula C30H38N4O6 and a molecular weight of 550.66 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23753243 |
| Molecular Formula | C30H38N4O6 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@@H]3CCC4(O3)C(C(=O)Nc3ccc(N(CC)CC)cc3)N(CCO)C(=O)[C@H]24)cc1 |
| InChI | InChI=1S/C30H38N4O6/c1-4-33(5-2)21-11-7-19(8-12-21)32-28(37)26-30-16-15-23(40-30)24(25(30)29(38)34(26)17-18-35)27(36)31-20-9-13-22(14-10-20)39-6-3/h7-14,23-26,35H,4-6,15-18H2,1-3H3,(H,31,36)(H,32,37)/t23-,24+,25-,26?,30?/m0/s1 |
| InChIKey | KZTNBAJUHUCFAO-AMFPOGBLSA-N |
| XLogP | 2.88 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|