C26H35N3O6 — CID 23924561
(5R,6R,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23924561) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23924561 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (5R,6R,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(CCO)C(C(=O)NC4CCCCC4)C34CC[C@H]2O4)cc1 |
| InChI | InChI=1S/C26H35N3O6/c1-2-34-18-10-8-17(9-11-18)27-23(31)20-19-12-13-26(35-19)21(20)25(33)29(14-15-30)22(26)24(32)28-16-6-4-3-5-7-16/h8-11,16,19-22,30H,2-7,12-15H2,1H3,(H,27,31)(H,28,32)/t19-,20+,21+,22?,26?/m1/s1 |
| InChIKey | LTGKTOIZUFLTMO-BNWPUIRCSA-N |
| XLogP | 1.84 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |