C34H46N4O5S — CID 23754335
(5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754335) has the molecular formula C34H46N4O5S and a molecular weight of 622.83 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754335 |
| Molecular Formula | C34H46N4O5S |
| Molecular Weight | 622.83 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(CCCCCCO)C(C(=O)Nc4ccc(N(CC)CC)cc4)C34CC[C@H]2S4)cc1 |
| InChI | InChI=1S/C34H46N4O5S/c1-4-37(5-2)25-15-11-23(12-16-25)36-32(41)30-34-20-19-27(44-34)28(29(34)33(42)38(30)21-9-7-8-10-22-39)31(40)35-24-13-17-26(18-14-24)43-6-3/h11-18,27-30,39H,4-10,19-22H2,1-3H3,(H,35,40)(H,36,41)/t27-,28+,29+,30?,34?/m1/s1 |
| InChIKey | NPKDVVMSPUJNRS-XWTWWLNUSA-N |
| XLogP | 5.15 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.83 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|