C26H30N2O5S — CID 23809865
ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-2-(naphthalen-2-ylcarbamoyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23809865) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-2-(naphthalen-2-ylcarbamoyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-2-(naphthalen-2-ylcarbamoyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23809865 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-2-(naphthalen-2-ylcarbamoyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)Nc2ccc4ccccc4c2)N(CCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C26H30N2O5S/c1-2-33-25(32)20-19-11-12-26(34-19)21(20)24(31)28(13-5-6-14-29)22(26)23(30)27-18-10-9-16-7-3-4-8-17(16)15-18/h3-4,7-10,15,19-22,29H,2,5-6,11-14H2,1H3,(H,27,30)/t19-,20+,21-,22?,26?/m0/s1 |
| InChIKey | UNYFTQMGVXLRQH-ZWADRTAASA-N |
| XLogP | 3.21 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|