C29H35N3O5S — CID 23925098
(5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-2-N-(4-methoxyphenyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925098) has the molecular formula C29H35N3O5S and a molecular weight of 537.68 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-2-N-(4-methoxyphenyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-2-N-(4-methoxyphenyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925098 |
| Molecular Formula | C29H35N3O5S |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-2-N-(4-methoxyphenyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2N(CCCCCO)C(=O)[C@@H]3[C@H](C(=O)NCc4ccccc4)[C@@H]4CCC23S4)cc1 |
| InChI | InChI=1S/C29H35N3O5S/c1-37-21-12-10-20(11-13-21)31-27(35)25-29-15-14-22(38-29)23(26(34)30-18-19-8-4-2-5-9-19)24(29)28(36)32(25)16-6-3-7-17-33/h2,4-5,8-13,22-25,33H,3,6-7,14-18H2,1H3,(H,30,34)(H,31,35)/t22-,23+,24-,25?,29?/m0/s1 |
| InChIKey | IARXUWRMOSQYAY-CRLPVRABSA-N |
| XLogP | 3.20 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|