C25H35N3O4S — CID 23925402
(5S,6S,7R)-6-N-benzyl-2-N-tert-butyl-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925402) has the molecular formula C25H35N3O4S and a molecular weight of 473.64 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-benzyl-2-N-tert-butyl-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-benzyl-2-N-tert-butyl-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925402 |
| Molecular Formula | C25H35N3O4S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (5S,6S,7R)-6-N-benzyl-2-N-tert-butyl-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)C1N(CCCCO)C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@H]3CCC12S3 |
| InChI | InChI=1S/C25H35N3O4S/c1-24(2,3)27-22(31)20-25-12-11-17(33-25)18(19(25)23(32)28(20)13-7-8-14-29)21(30)26-15-16-9-5-4-6-10-16/h4-6,9-10,17-20,29H,7-8,11-15H2,1-3H3,(H,26,30)(H,27,31)/t17-,18+,19+,20?,25?/m1/s1 |
| InChIKey | ATOYNQPRYGBCPO-RXVIIHFTSA-N |
| XLogP | 2.08 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|