C31H38ClN3O6 — CID 23842080
(5R,6S,7S)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23842080) has the molecular formula C31H38ClN3O6 and a molecular weight of 584.11 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23842080 |
| Molecular Formula | C31H38ClN3O6 |
| Molecular Weight | 584.11 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N([C@@H](CO)C(C)C)C(C(=O)Nc4ccccc4Cl)C34CC(C)[C@]2(C)O4)cc1 |
| InChI | InChI=1S/C31H38ClN3O6/c1-6-40-20-13-11-19(12-14-20)33-27(37)24-25-29(39)35(23(16-36)17(2)3)26(31(25)15-18(4)30(24,5)41-31)28(38)34-22-10-8-7-9-21(22)32/h7-14,17-18,23-26,36H,6,15-16H2,1-5H3,(H,33,37)(H,34,38)/t18?,23-,24+,25-,26?,30-,31?/m0/s1 |
| InChIKey | WIGSAWPJRSJNNB-FEIZZCQHSA-N |
| XLogP | 4.34 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.11 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |