C29H43N3O6 — CID 23898290
(5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N-propan-2-yl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23898290) has the molecular formula C29H43N3O6 and a molecular weight of 529.68 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N-propan-2-yl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N-propan-2-yl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23898290 |
| Molecular Formula | C29H43N3O6 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-2-N-propan-2-yl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N(CCCCCCO)C(C(=O)NC(C)C)C34CC(C)[C@]2(C)O4)cc1 |
| InChI | InChI=1S/C29H43N3O6/c1-6-37-21-13-11-20(12-14-21)31-25(34)22-23-27(36)32(15-9-7-8-10-16-33)24(26(35)30-18(2)3)29(23)17-19(4)28(22,5)38-29/h11-14,18-19,22-24,33H,6-10,15-17H2,1-5H3,(H,30,35)(H,31,34)/t19?,22-,23+,24?,28+,29?/m1/s1 |
| InChIKey | IXDFOLAELULAEE-KMDXWXLNSA-N |
| XLogP | 3.11 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|