C28H34N2O6 — CID 23751822
ethyl (5R,6S,7S)-3-(4-hydroxybutyl)-7,8-dimethyl-2-(naphthalen-2-ylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23751822) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is ethyl (5R,6S,7S)-3-(4-hydroxybutyl)-7,8-dimethyl-2-(naphthalen-2-ylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7S)-3-(4-hydroxybutyl)-7,8-dimethyl-2-(naphthalen-2-ylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23751822 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | ethyl (5R,6S,7S)-3-(4-hydroxybutyl)-7,8-dimethyl-2-(naphthalen-2-ylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCO)C(C(=O)Nc3ccc4ccccc4c3)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C28H34N2O6/c1-4-35-26(34)22-21-25(33)30(13-7-8-14-31)23(28(21)16-17(2)27(22,3)36-28)24(32)29-20-12-11-18-9-5-6-10-19(18)15-20/h5-6,9-12,15,17,21-23,31H,4,7-8,13-14,16H2,1-3H3,(H,29,32)/t17?,21-,22+,23?,27-,28?/m0/s1 |
| InChIKey | NTKVTVALPNKTNZ-PKSZYSDUSA-N |
| XLogP | 3.12 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|