C32H40ClN3O6 — CID 23811513
(5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23811513) has the molecular formula C32H40ClN3O6 and a molecular weight of 598.14 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23811513 |
| Molecular Formula | C32H40ClN3O6 |
| Molecular Weight | 598.14 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | (5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N([C@@H](CO)C(C)C)C(C(=O)Nc4c(C)cccc4Cl)C34CC[C@]2(CC)O4)cc1 |
| InChI | InChI=1S/C32H40ClN3O6/c1-6-31-15-16-32(42-31)25(24(31)28(38)34-20-11-13-21(14-12-20)41-7-2)30(40)36(23(17-37)18(3)4)27(32)29(39)35-26-19(5)9-8-10-22(26)33/h8-14,18,23-25,27,37H,6-7,15-17H2,1-5H3,(H,34,38)(H,35,39)/t23-,24+,25-,27?,31-,32?/m0/s1 |
| InChIKey | LCOSCOHAQUZWHJ-YBIMGVBLSA-N |
| XLogP | 4.80 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.14 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |