C36H41N3O6 — CID 23868645
(5R,6S,7S)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868645) has the molecular formula C36H41N3O6 and a molecular weight of 611.74 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868645 |
| Molecular Formula | C36H41N3O6 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | (5R,6S,7S)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N([C@H](CO)c4ccccc4)C(C(=O)Nc4cc(C)ccc4C)C34CC[C@]2(CC)O4)cc1 |
| InChI | InChI=1S/C36H41N3O6/c1-5-35-18-19-36(45-35)30(29(35)32(41)37-25-14-16-26(17-15-25)44-6-2)34(43)39(28(21-40)24-10-8-7-9-11-24)31(36)33(42)38-27-20-22(3)12-13-23(27)4/h7-17,20,28-31,40H,5-6,18-19,21H2,1-4H3,(H,37,41)(H,38,42)/t28-,29-,30+,31?,35+,36?/m1/s1 |
| InChIKey | LIYPELNICSTJII-RUYAMWRLSA-N |
| XLogP | 5.17 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |