C34H37N3O5 — CID 23784692
(5R,6R,7R)-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23784692) has the molecular formula C34H37N3O5 and a molecular weight of 567.69 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23784692 |
| Molecular Formula | C34H37N3O5 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (5R,6R,7R)-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2N([C@H](CO)c3ccccc3)C(=O)[C@@H]3[C@@H](C(=O)Nc4ccccc4)[C@]4(C)OC23CC4C)c1 |
| InChI | InChI=1S/C34H37N3O5/c1-20-15-16-21(2)25(17-20)36-31(40)29-34-18-22(3)33(4,42-34)27(30(39)35-24-13-9-6-10-14-24)28(34)32(41)37(29)26(19-38)23-11-7-5-8-12-23/h5-17,22,26-29,38H,18-19H2,1-4H3,(H,35,39)(H,36,40)/t22?,26-,27+,28+,29?,33-,34?/m1/s1 |
| InChIKey | DPNGQYLQYSSFSV-VBYPEFEUSA-N |
| XLogP | 4.62 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |