C31H33N3O5 — CID 23842133
(5R,6S,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-6-N,7,8-trimethyl-2-N-naphthalen-2-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23842133) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is (5R,6S,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-6-N,7,8-trimethyl-2-N-naphthalen-2-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-6-N,7,8-trimethyl-2-N-naphthalen-2-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23842133 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | (5R,6S,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-6-N,7,8-trimethyl-2-N-naphthalen-2-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@H]2C(=O)N([C@H](CO)c3ccccc3)C(C(=O)Nc3ccc4ccccc4c3)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C31H33N3O5/c1-18-16-31-25(24(27(36)32-3)30(18,2)39-31)29(38)34(23(17-35)20-10-5-4-6-11-20)26(31)28(37)33-22-14-13-19-9-7-8-12-21(19)15-22/h4-15,18,23-26,35H,16-17H2,1-3H3,(H,32,36)(H,33,37)/t18?,23-,24-,25+,26?,30+,31?/m1/s1 |
| InChIKey | VFVMNSWXZVXWRQ-HKHUIJEBSA-N |
| XLogP | 3.27 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |